C38H22N4OPt — CID 164734292
CID 164734292 (PubChem CID 164734292) has the molecular formula C38H22N4OPt and a molecular weight of 745.70 g/mol.
| Compound Name | CID 164734292 |
|---|---|
| PubChem CID | 164734292 |
| Molecular Formula | C38H22N4OPt |
| Molecular Weight | 745.70 g/mol |
| Exact Mass | 745.14 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1-n1nccc1-c1ccccc1-c1ccccc1-2 |
| InChI | InChI=1S/C38H22N4O.Pt/c1-2-11-29-27(9-1)28-10-3-4-12-30(28)35-20-22-40-42(35)37-24-26(16-18-32(29)37)43-25-17-19-33-31-13-5-6-14-34(31)41(36(33)23-25)38-15-7-8-21-39-38;/h1-22H;/q-2;+2 |
| InChIKey | HETUBGFZAIWMKC-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.70 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|