About CID 153429014
CID 153429014 (PubChem CID 153429014) has the molecular formula C46H24N4O3Pt
and a molecular weight of 875.80 g/mol.
Molecular Properties
| Compound Name | CID 153429014 |
| PubChem CID | 153429014 |
| Molecular Formula | C46H24N4O3Pt |
| Molecular Weight | 875.80 g/mol |
| Exact Mass | 875.15 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2c4c(ccc2n3-c2ccccn2)oc2ccccc24)ccc2c3c4c(ccc3n(-c3ccccn3)c12)oc1ccccc14 |
| InChI | InChI=1S/C46H24N4O3.Pt/c1-3-11-37-31(9-1)45-39(52-37)21-19-33-43(45)29-17-15-27(25-35(29)49(33)41-13-5-7-23-47-41)51-28-16-18-30-36(26-28)50(42-14-6-8-24-48-42)34-20-22-40-46(44(30)34)32-10-2-4-12-38(32)53-40;/h1-24H;/q-2;+2 |
| InChIKey | NSYPOKXDNZPCFF-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 875.80 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153429014 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153429014?
The IUPAC name of CID 153429014 (CID 153429014) is not available.
What is the SMILES notation for CID 153429014?
The canonical SMILES for CID 153429014 is [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2c4c(ccc2n3-c2ccccn2)oc2ccccc24)ccc2c3c4c(ccc3n(-c3ccccn3)c12)oc1ccccc14.
What is the InChIKey of CID 153429014?
The InChIKey is NSYPOKXDNZPCFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H24N4O3.Pt/c1-3-11-37-31(9-1)45-39(52-37)21-19-33-43(45)29-17-15-27(25-35(29)49(33)41-13-5-7-23-47-41)51-28-16-18-30-36(26-28)50(42-14-6-8-24-48-42)34-20-22-40-46(44(30)34)32-10-2-4-12-38(32)53-40;/h1-24H;/q-2;+2.
What are the key properties of CID 153429014?
CID 153429014 has a molecular weight of 875.80 g/mol, XLogP of 11.86, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153429014 is sourced from PubChem (CID 153429014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).