C39H21FN4OPt — CID 162461468
3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-5-pyridin-2-yl-4H-[1]benzofuro[3,2-c]carbazol-4-ide;platinum(2+) (PubChem CID 162461468) has the molecular formula C39H21FN4OPt and a molecular weight of 775.70 g/mol. Its IUPAC name is 3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-5-pyridin-2-yl-4H-[1]benzofuro[3,2-c]carbazol-4-ide;platinum(2+).
| Compound Name | 3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-5-pyridin-2-yl-4H-[1]benzofuro[3,2-c]carbazol-4-ide;platinum(2+) |
|---|---|
| PubChem CID | 162461468 |
| Molecular Formula | C39H21FN4OPt |
| Molecular Weight | 775.70 g/mol |
| Exact Mass | 775.13 |
| IUPAC Name | 3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-5-pyridin-2-yl-4H-[1]benzofuro[3,2-c]carbazol-4-ide;platinum(2+) |
| SMILES | FC(c1[c-]c2c(cc1)c1ccccc1n1ccnc21)c1[c-]c2c(cc1)c1c3oc4ccccc4c3ccc1n2-c1ccccn1.[Pt+2] |
| InChI | InChI=1S/C39H21FN4O.Pt/c40-37(23-12-14-25-26-7-1-3-9-31(26)43-20-19-42-39(43)30(25)21-23)24-13-15-29-33(22-24)44(35-11-5-6-18-41-35)32-17-16-28-27-8-2-4-10-34(27)45-38(28)36(29)32;/h1-20,37H;/q-2;+2 |
| InChIKey | SHFVHZSWYMVVLP-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 48.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.70 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|