C48H32FN5Pt — CID 162461414
3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-13,13-dimethyl-8-phenyl-5-pyridin-2-yl-4H-indolo[3,2-a]acridin-4-ide;platinum(2+) (PubChem CID 162461414) has the molecular formula C48H32FN5Pt and a molecular weight of 892.90 g/mol. Its IUPAC name is 3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-13,13-dimethyl-8-phenyl-5-pyridin-2-yl-4H-indolo[3,2-a]acridin-4-ide;platinum(2+).
| Compound Name | 3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-13,13-dimethyl-8-phenyl-5-pyridin-2-yl-4H-indolo[3,2-a]acridin-4-ide;platinum(2+) |
|---|---|
| PubChem CID | 162461414 |
| Molecular Formula | C48H32FN5Pt |
| Molecular Weight | 892.90 g/mol |
| Exact Mass | 892.23 |
| IUPAC Name | 3-[fluoro(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)methyl]-13,13-dimethyl-8-phenyl-5-pyridin-2-yl-4H-indolo[3,2-a]acridin-4-ide;platinum(2+) |
| SMILES | CC1(C)c2ccc(C(F)c3[c-]c4c(cc3)c3ccccc3n3ccnc43)[c-]c2N(c2ccccn2)c2ccc3c(c21)c1ccccc1n3-c1ccccc1.[Pt+2] |
| InChI | InChI=1S/C48H32FN5.Pt/c1-48(2)37-22-20-31(46(49)30-19-21-33-34-14-6-8-16-38(34)52-27-26-51-47(52)36(33)28-30)29-42(37)54(43-18-10-11-25-50-43)41-24-23-40-44(45(41)48)35-15-7-9-17-39(35)53(40)32-12-4-3-5-13-32;/h3-27,46H,1-2H3;/q-2;+2 |
| InChIKey | NVVYOYLPGPZCFZ-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.90 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|