C53H36N4PtSSi — CID 162461410
(13,13-dimethyl-8-pyridin-2-yl-9H-[1]benzothiolo[3,2-a]acridin-9-id-10-yl)-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)-diphenylsilane;platinum(2+) (PubChem CID 162461410) has the molecular formula C53H36N4PtSSi and a molecular weight of 984.13 g/mol. Its IUPAC name is (13,13-dimethyl-8-pyridin-2-yl-9H-[1]benzothiolo[3,2-a]acridin-9-id-10-yl)-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)-diphenylsilane;platinum(2+).
| Compound Name | (13,13-dimethyl-8-pyridin-2-yl-9H-[1]benzothiolo[3,2-a]acridin-9-id-10-yl)-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)-diphenylsilane;platinum(2+) |
|---|---|
| PubChem CID | 162461410 |
| Molecular Formula | C53H36N4PtSSi |
| Molecular Weight | 984.13 g/mol |
| Exact Mass | 983.21 |
| IUPAC Name | (13,13-dimethyl-8-pyridin-2-yl-9H-[1]benzothiolo[3,2-a]acridin-9-id-10-yl)-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yl)-diphenylsilane;platinum(2+) |
| SMILES | CC1(C)c2ccc([Si](c3[c-]c4c(cc3)c3ccccc3n3ccnc43)(c3ccccc3)c3ccccc3)[c-]c2N(c2ccccn2)c2ccc3sc4ccccc4c3c21.[Pt+2] |
| InChI | InChI=1S/C53H36N4SSi.Pt/c1-53(2)43-27-25-38(34-46(43)57(49-23-13-14-30-54-49)45-28-29-48-50(51(45)53)41-20-10-12-22-47(41)58-48)59(35-15-5-3-6-16-35,36-17-7-4-8-18-36)37-24-26-39-40-19-9-11-21-44(40)56-32-31-55-52(56)42(39)33-37;/h3-32H,1-2H3;/q-2;+2 |
| InChIKey | GLJYUCOSGWWNDP-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.13 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|