C44H26N4OPt-2 — CID 164734181
CID 164734181 (PubChem CID 164734181) has the molecular formula C44H26N4OPt-2 and a molecular weight of 821.80 g/mol.
| Compound Name | CID 164734181 |
|---|---|
| PubChem CID | 164734181 |
| Molecular Formula | C44H26N4OPt-2 |
| Molecular Weight | 821.80 g/mol |
| Exact Mass | 821.18 |
| IUPAC Name | — |
| SMILES | [Pt]=c1n(-c2ccccc2)cc2n1-c1[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)ccc1-c1ccccc1-c1ccccc1-2 |
| InChI | InChI=1S/C44H26N4O.Pt/c1-2-12-30(13-3-1)46-28-43-36-17-7-6-15-34(36)33-14-4-5-16-35(33)38-23-21-31(26-41(38)47(43)29-46)49-32-22-24-39-37-18-8-9-19-40(37)48(42(39)27-32)44-20-10-11-25-45-44;/h1-25,28H;/q-2; |
| InChIKey | ZNAPDERAEIQGIQ-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 36.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.80 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|