C38H24BN4O2Pt-3 — CID 155616560
2,4-diphenyl-8-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-1,9-dihydroimidazo[5,1-c][1,4,2]benzoxazaborinine-1,9-diide;platinum (PubChem CID 155616560) has the molecular formula C38H24BN4O2Pt-3 and a molecular weight of 774.53 g/mol. Its IUPAC name is 2,4-diphenyl-8-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-1,9-dihydroimidazo[5,1-c][1,4,2]benzoxazaborinine-1,9-diide;platinum.
| Compound Name | 2,4-diphenyl-8-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-1,9-dihydroimidazo[5,1-c][1,4,2]benzoxazaborinine-1,9-diide;platinum |
|---|---|
| PubChem CID | 155616560 |
| Molecular Formula | C38H24BN4O2Pt-3 |
| Molecular Weight | 774.53 g/mol |
| Exact Mass | 774.17 |
| IUPAC Name | 2,4-diphenyl-8-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-1,9-dihydroimidazo[5,1-c][1,4,2]benzoxazaborinine-1,9-diide;platinum |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1N1[CH-]N(c3ccccc3)C=C1B(c1ccccc1)O2 |
| InChI | InChI=1S/C38H24BN4O2.Pt/c1-3-11-27(12-4-1)39-37-25-41(28-13-5-2-6-14-28)26-42(37)35-24-30(19-21-36(35)45-39)44-29-18-20-32-31-15-7-8-16-33(31)43(34(32)23-29)38-17-9-10-22-40-38;/h1-22,25-26H;/q-3; |
| InChIKey | PEIGZOVCFPCPLT-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.53 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|