C85H53N4OPt-3 — CID 155616486
CID 155616486 (PubChem CID 155616486) has the molecular formula C85H53N4OPt-3 and a molecular weight of 1341.46 g/mol.
| Compound Name | CID 155616486 |
|---|---|
| PubChem CID | 155616486 |
| Molecular Formula | C85H53N4OPt-3 |
| Molecular Weight | 1341.46 g/mol |
| Exact Mass | 1340.39 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1N1[CH-]N(c3c(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cccc3-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3cccc(c31)C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C85H53N4O.Pt/c1-5-23-56(24-6-1)60-47-61(57-25-7-2-8-26-57)50-64(49-60)68-34-21-35-69(65-51-62(58-27-9-3-10-28-58)48-63(52-65)59-29-11-4-12-30-59)83(68)87-55-88-81-54-67(90-66-42-44-73-72-33-15-18-39-78(72)89(80(73)53-66)82-41-19-20-46-86-82)43-45-76(81)85(77-38-22-40-79(87)84(77)88)74-36-16-13-31-70(74)71-32-14-17-37-75(71)85;/h1-52,55H;/q-3; |
| InChIKey | VVORQNYNYCGBIB-UHFFFAOYSA-N |
| XLogP | 21.66 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1341.46 |
| LogP ≤ 5 | 21.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|