C48H29N4O2Pt-3 — CID 155616746
CID 155616746 (PubChem CID 155616746) has the molecular formula C48H29N4O2Pt-3 and a molecular weight of 888.86 g/mol.
| Compound Name | CID 155616746 |
|---|---|
| PubChem CID | 155616746 |
| Molecular Formula | C48H29N4O2Pt-3 |
| Molecular Weight | 888.86 g/mol |
| Exact Mass | 888.20 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1N1[CH-]N(c3c(-c4ccccc4)cccc3-c3ccccc3)c3cccc(c31)O2 |
| InChI | InChI=1S/C48H29N4O2.Pt/c1-3-13-32(14-4-1)36-18-11-19-37(33-15-5-2-6-16-33)47(36)50-31-51-43-30-35(25-27-44(43)54-45-22-12-21-41(50)48(45)51)53-34-24-26-39-38-17-7-8-20-40(38)52(42(39)29-34)46-23-9-10-28-49-46;/h1-28,31H;/q-3; |
| InChIKey | MHTAYWYZESTYOM-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.86 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|