C41H24N4OPt — CID 164704200
CID 164704200 (PubChem CID 164704200) has the molecular formula C41H24N4OPt and a molecular weight of 783.75 g/mol.
| Compound Name | CID 164704200 |
|---|---|
| PubChem CID | 164704200 |
| Molecular Formula | C41H24N4OPt |
| Molecular Weight | 783.75 g/mol |
| Exact Mass | 783.16 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1-c1cn2c3ccccc3c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n4c6ccccc6nc54)[c-]c3c2n1.[Pt+2] |
| InChI | InChI=1S/C41H24N4O.Pt/c1-25-10-2-3-11-28(25)36-24-44-37-15-7-4-12-31(37)29-20-18-26(22-33(29)40(44)43-36)46-27-19-21-30-32-13-5-8-16-38(32)45-39-17-9-6-14-35(39)42-41(45)34(30)23-27;/h2-21,24H,1H3;/q-2;+2 |
| InChIKey | MFKVFPPQYHCBBI-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.75 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|