About CID 154611162
CID 154611162 (PubChem CID 154611162) has the molecular formula C52H34N6OPd
and a molecular weight of 865.31 g/mol.
Molecular Properties
| Compound Name | CID 154611162 |
| PubChem CID | 154611162 |
| Molecular Formula | C52H34N6OPd |
| Molecular Weight | 865.31 g/mol |
| Exact Mass | 864.18 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1ccc(-c2c(C)cccc2C)c2c1c1ccc(Oc3[c-]c4c(cc3)c3nccnc3n3c5ccccc5nc43)[c-]c1c1nc3ccccc3n12.[Pd+2] |
| InChI | InChI=1S/C52H34N6O.Pd/c1-29-11-9-12-30(2)45(29)37-23-24-38(46-31(3)13-10-14-32(46)4)49-47(37)35-21-19-33(27-39(35)50-55-41-15-5-7-17-43(41)57(49)50)59-34-20-22-36-40(28-34)51-56-42-16-6-8-18-44(42)58(51)52-48(36)53-25-26-54-52;/h5-26H,1-4H3;/q-2;+2 |
| InChIKey | GXLFWKQKEZEDOL-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 865.31 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154611162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154611162?
The IUPAC name of CID 154611162 (CID 154611162) is not available.
What is the SMILES notation for CID 154611162?
The canonical SMILES for CID 154611162 is Cc1cccc(C)c1-c1ccc(-c2c(C)cccc2C)c2c1c1ccc(Oc3[c-]c4c(cc3)c3nccnc3n3c5ccccc5nc43)[c-]c1c1nc3ccccc3n12.[Pd+2].
What is the InChIKey of CID 154611162?
The InChIKey is GXLFWKQKEZEDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H34N6O.Pd/c1-29-11-9-12-30(2)45(29)37-23-24-38(46-31(3)13-10-14-32(46)4)49-47(37)35-21-19-33(27-39(35)50-55-41-15-5-7-17-43(41)57(49)50)59-34-20-22-36-40(28-34)51-56-42-16-6-8-18-44(42)58(51)52-48(36)53-25-26-54-52;/h5-26H,1-4H3;/q-2;+2.
What are the key properties of CID 154611162?
CID 154611162 has a molecular weight of 865.31 g/mol, XLogP of 12.65, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154611162 is sourced from PubChem (CID 154611162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).