C54H36N4OPd — CID 154611454
CID 154611454 (PubChem CID 154611454) has the molecular formula C54H36N4OPd and a molecular weight of 863.33 g/mol.
| Compound Name | CID 154611454 |
|---|---|
| PubChem CID | 154611454 |
| Molecular Formula | C54H36N4OPd |
| Molecular Weight | 863.33 g/mol |
| Exact Mass | 862.19 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1ccc2c(c1)c1ccc(Oc3[c-]c4c(cc3)c3cc(-c5c(C)cccc5C)ccc3n3c5ccccc5nc43)[c-]c1c1nc3ccccc3n21.[Pd+2] |
| InChI | InChI=1S/C54H36N4O.Pd/c1-31-11-9-12-32(2)51(31)35-19-25-47-41(27-35)39-23-21-37(29-43(39)53-55-45-15-5-7-17-49(45)57(47)53)59-38-22-24-40-42-28-36(52-33(3)13-10-14-34(52)4)20-26-48(42)58-50-18-8-6-16-46(50)56-54(58)44(40)30-38;/h5-28H,1-4H3;/q-2;+2 |
| InChIKey | CUZXTKPDPSZWNW-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.33 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|