C40H26N6OPd — CID 154611614
CID 154611614 (PubChem CID 154611614) has the molecular formula C40H26N6OPd and a molecular weight of 713.11 g/mol.
| Compound Name | CID 154611614 |
|---|---|
| PubChem CID | 154611614 |
| Molecular Formula | C40H26N6OPd |
| Molecular Weight | 713.11 g/mol |
| Exact Mass | 712.12 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccc(Oc3[c-]c4c(cc3)c3cncnc3n3c5ccccc5nc43)[c-]c1c1nc3ccccc3n21.[Pd+2] |
| InChI | InChI=1S/C40H26N6O.Pd/c1-40(2,3)23-12-17-34-28(18-23)26-15-13-24(19-29(26)38-43-32-8-4-6-10-35(32)45(34)38)47-25-14-16-27-30(20-25)39-44-33-9-5-7-11-36(33)46(39)37-31(27)21-41-22-42-37;/h4-18,21-22H,1-3H3;/q-2;+2 |
| InChIKey | QBKFCZBTANGHGH-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.11 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|