C62H52N4OPd — CID 154610624
CID 154610624 (PubChem CID 154610624) has the molecular formula C62H52N4OPd and a molecular weight of 975.54 g/mol.
| Compound Name | CID 154610624 |
|---|---|
| PubChem CID | 154610624 |
| Molecular Formula | C62H52N4OPd |
| Molecular Weight | 975.54 g/mol |
| Exact Mass | 974.32 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccc2c(c1)c1ccc(Oc3[c-]c4c(cc3)c3ccc(-c5c(C(C)C)cccc5C(C)C)cc3n3c5ccccc5nc43)[c-]c1c1nc3ccccc3n21.[Pd+2] |
| InChI | InChI=1S/C62H52N4O.Pd/c1-35(2)43-15-13-16-44(36(3)4)59(43)39-24-30-55-50(31-39)48-29-26-42(34-52(48)61-63-53-19-9-11-21-56(53)65(55)61)67-41-25-28-47-49-27-23-40(60-45(37(5)6)17-14-18-46(60)38(7)8)32-58(49)66-57-22-12-10-20-54(57)64-62(66)51(47)33-41;/h9-32,35-38H,1-8H3;/q-2;+2 |
| InChIKey | JMUXCSPOBFDTKN-UHFFFAOYSA-N |
| XLogP | 17.12 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.54 |
| LogP ≤ 5 | 17.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|