C53H39N5Pt-2 — CID 164701916
CID 164701916 (PubChem CID 164701916) has the molecular formula C53H39N5Pt-2 and a molecular weight of 944.03 g/mol.
| Compound Name | CID 164701916 |
|---|---|
| PubChem CID | 164701916 |
| Molecular Formula | C53H39N5Pt-2 |
| Molecular Weight | 944.03 g/mol |
| Exact Mass | 943.31 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])[n+]1[c-]n(-c2[c-]c3c(cc2)c2ccccc2c2ccccc2c2ccccc2n3-c2[c-]c3c(cc2)c2ccccc2n3-c2cc(C(C)(C)C)ccn2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C53H39N5.Pt/c1-53(2,3)35-29-30-54-52(31-35)58-47-22-12-10-20-43(47)45-28-26-37(33-51(45)58)57-46-21-11-9-19-42(46)40-17-7-5-15-38(40)39-16-6-8-18-41(39)44-27-25-36(32-50(44)57)56-34-55(4)48-23-13-14-24-49(48)56;/h5-31H,1-4H3;/q-2;/i4D3; |
| InChIKey | CGROQECOVPGPLN-NXIGQQGZSA-N |
| XLogP | 12.17 |
| TPSA | 31.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.03 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|