C39H36N4OPt-2 — CID 176775980
2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum (PubChem CID 176775980) has the molecular formula C39H36N4OPt-2 and a molecular weight of 771.82 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176775980 |
| Molecular Formula | C39H36N4OPt-2 |
| Molecular Weight | 771.82 g/mol |
| Exact Mass | 771.25 |
| IUPAC Name | 2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum |
| SMILES | C[n+]1[c-]n(-c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)cc(C(C)(C)C)c2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C39H36N4O.Pt/c1-38(2,3)26-18-19-40-37(22-26)43-33-13-9-8-12-31(33)32-17-16-29(24-36(32)43)44-30-21-27(39(4,5)6)20-28(23-30)42-25-41(7)34-14-10-11-15-35(34)42;/h8-22H,1-7H3;/q-2; |
| InChIKey | PNTHXZDJGASALT-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.82 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|