C52H48N4OPt-2 — CID 176775950
9-[4-[2-adamantyl(phenyl)methyl]-2-pyridinyl]-2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-1H-carbazol-1-ide;platinum (PubChem CID 176775950) has the molecular formula C52H48N4OPt-2 and a molecular weight of 940.06 g/mol. Its IUPAC name is 9-[4-[2-adamantyl(phenyl)methyl]-2-pyridinyl]-2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-1H-carbazol-1-ide;platinum.
| Compound Name | 9-[4-[2-adamantyl(phenyl)methyl]-2-pyridinyl]-2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176775950 |
| Molecular Formula | C52H48N4OPt-2 |
| Molecular Weight | 940.06 g/mol |
| Exact Mass | 939.35 |
| IUPAC Name | 9-[4-[2-adamantyl(phenyl)methyl]-2-pyridinyl]-2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)benzene-6-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
| SMILES | C[n+]1[c-]n(-c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(c4ccccc4)C4C5CC6CC(C5)CC4C6)ccn3)cc(C(C)(C)C)c2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C52H48N4O.Pt/c1-52(2,3)39-28-40(55-32-54(4)46-16-10-11-17-47(46)55)30-42(29-39)57-41-18-19-44-43-14-8-9-15-45(43)56(48(44)31-41)49-27-36(20-21-53-49)50(35-12-6-5-7-13-35)51-37-23-33-22-34(25-37)26-38(51)24-33;/h5-21,27-29,33-34,37-38,50-51H,22-26H2,1-4H3;/q-2; |
| InChIKey | PXAFYEGISHXCAB-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.06 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|