C48H38N4Pt-2 — CID 170930584
CID 170930584 (PubChem CID 170930584) has the molecular formula C48H38N4Pt-2 and a molecular weight of 868.96 g/mol.
| Compound Name | CID 170930584 |
|---|---|
| PubChem CID | 170930584 |
| Molecular Formula | C48H38N4Pt-2 |
| Molecular Weight | 868.96 g/mol |
| Exact Mass | 868.29 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])[n+]1[c-]n(-c2[c-]c(Cc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc2)c2ccccc2c2ccccc2c2ccccc21.[Pt] |
| InChI | InChI=1S/C48H38N4.Pt/c1-48(2,3)35-26-27-49-47(31-35)52-45-23-12-9-20-41(45)42-25-24-34(30-46(42)52)28-33-14-13-15-36(29-33)51-32-50(4)43-21-10-7-18-39(43)37-16-5-6-17-38(37)40-19-8-11-22-44(40)51;/h5-27,31H,28H2,1-4H3;/q-2;/i4D3; |
| InChIKey | RVUQDSVXPLMNDT-NXIGQQGZSA-N |
| XLogP | 10.66 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.96 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|