C43H32N4OPt-2 — CID 171415953
5-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]methyl]-1H-carbazol-1-id-9-yl]furo[2,3-c]pyridine;platinum (PubChem CID 171415953) has the molecular formula C43H32N4OPt-2 and a molecular weight of 815.83 g/mol. Its IUPAC name is 5-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]methyl]-1H-carbazol-1-id-9-yl]furo[2,3-c]pyridine;platinum.
| Compound Name | 5-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]methyl]-1H-carbazol-1-id-9-yl]furo[2,3-c]pyridine;platinum |
|---|---|
| PubChem CID | 171415953 |
| Molecular Formula | C43H32N4OPt-2 |
| Molecular Weight | 815.83 g/mol |
| Exact Mass | 815.22 |
| IUPAC Name | 5-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]methyl]-1H-carbazol-1-id-9-yl]furo[2,3-c]pyridine;platinum |
| SMILES | CC(C)(C)c1ccccc1-[n+]1[c-]n(-c2[c-]c(Cc3[c-]c4c(cc3)c3ccccc3n4-c3cc4ccoc4cn3)ccc2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C43H32N4O.Pt/c1-43(2,3)35-14-5-7-16-37(35)46-28-45(38-17-8-9-18-39(38)46)32-12-10-11-29(24-32)23-30-19-20-34-33-13-4-6-15-36(33)47(40(34)25-30)42-26-31-21-22-48-41(31)27-44-42;/h4-22,26-27H,23H2,1-3H3;/q-2; |
| InChIKey | FSKWISUYRYBLGN-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 39.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.83 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|