C43H34N4O — CID 171416087
4-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]furo[3,2-c]pyridine (PubChem CID 171416087) has the molecular formula C43H34N4O and a molecular weight of 622.77 g/mol. Its IUPAC name is 4-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 171416087 |
| Molecular Formula | C43H34N4O |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 4-[2-[[3-[3-(2-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenyl]methyl]carbazol-9-yl]furo[3,2-c]pyridine |
| SMILES | CC(C)(C)c1ccccc1-[n+]1[c-]n(-c2cccc(Cc3ccc4c5ccccc5n(-c5nccc6occc56)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C43H34N4O/c1-43(2,3)35-14-5-7-16-37(35)46-28-45(38-17-8-9-18-39(38)46)31-12-10-11-29(26-31)25-30-19-20-33-32-13-4-6-15-36(32)47(40(33)27-30)42-34-22-24-48-41(34)21-23-44-42/h4-24,26-27H,25H2,1-3H3 |
| InChIKey | LILXMKUCSJTEAT-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 39.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|