C72H80N4O — CID 170518715
2-[3-[3-[4-tert-butyl-2,6-bis(3,5-ditert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 170518715) has the molecular formula C72H80N4O and a molecular weight of 1017.46 g/mol. Its IUPAC name is 2-[3-[3-[4-tert-butyl-2,6-bis(3,5-ditert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[3-[4-tert-butyl-2,6-bis(3,5-ditert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 170518715 |
| Molecular Formula | C72H80N4O |
| Molecular Weight | 1017.46 g/mol |
| Exact Mass | 1016.63 |
| IUPAC Name | 2-[3-[3-[4-tert-butyl-2,6-bis(3,5-ditert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2-[n+]2[c-]n(-c3cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C72H80N4O/c1-67(2,3)48-32-33-73-65(42-48)76-61-27-20-19-26-57(61)58-31-30-56(44-64(58)76)77-55-25-23-24-54(43-55)74-45-75(63-29-22-21-28-62(63)74)66-59(46-34-49(68(4,5)6)38-50(35-46)69(7,8)9)40-53(72(16,17)18)41-60(66)47-36-51(70(10,11)12)39-52(37-47)71(13,14)15/h19-44H,1-18H3 |
| InChIKey | GEFNKQJGNPOBLG-UHFFFAOYSA-N |
| XLogP | 19.11 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.46 |
| LogP ≤ 5 | 19.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|