C51H50N4OSi2 — CID 171057265
[2-[3-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2H-benzimidazol-1-ium-2-id-1-yl]-3-phenylphenyl]-dimethyl-trimethylsilylsilane (PubChem CID 171057265) has the molecular formula C51H50N4OSi2 and a molecular weight of 791.16 g/mol. Its IUPAC name is [2-[3-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2H-benzimidazol-1-ium-2-id-1-yl]-3-phenylphenyl]-dimethyl-trimethylsilylsilane.
| Compound Name | [2-[3-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2H-benzimidazol-1-ium-2-id-1-yl]-3-phenylphenyl]-dimethyl-trimethylsilylsilane |
|---|---|
| PubChem CID | 171057265 |
| Molecular Formula | C51H50N4OSi2 |
| Molecular Weight | 791.16 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | [2-[3-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-2H-benzimidazol-1-ium-2-id-1-yl]-3-phenylphenyl]-dimethyl-trimethylsilylsilane |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c(-c7ccccc7)cccc6[Si](C)(C)[Si](C)(C)C)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C51H50N4OSi2/c1-51(2,3)37-30-31-52-49(32-37)55-44-24-13-12-22-42(44)43-29-28-40(34-47(43)55)56-39-21-16-20-38(33-39)53-35-54(46-26-15-14-25-45(46)53)50-41(36-18-10-9-11-19-36)23-17-27-48(50)58(7,8)57(4,5)6/h9-34H,1-8H3 |
| InChIKey | XUUZUTDFCCWFOT-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.16 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|