C61H58N4O — CID 171609998
2-[3-[3-[2,6-bis(3-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]carbazole (PubChem CID 171609998) has the molecular formula C61H58N4O and a molecular weight of 865.17 g/mol. Its IUPAC name is 2-[3-[3-[2,6-bis(3-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]carbazole.
| Compound Name | 2-[3-[3-[2,6-bis(3-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 171609998 |
| Molecular Formula | C61H58N4O |
| Molecular Weight | 865.17 g/mol |
| Exact Mass | 864.47 |
| IUPAC Name | 2-[3-[3-[2,6-bis(3-tert-butylphenyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]carbazole |
| SMILES | [2H]C([2H])(c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c(-c7cccc(C(C)(C)C)c7)cccc6-c6cccc(C(C)(C)C)c6)c6ccccc65)c4)cc32)c1)C(C)(C)C |
| InChI | InChI=1S/C61H58N4O/c1-59(2,3)39-41-32-33-62-57(34-41)65-53-27-11-10-24-51(53)52-31-30-48(38-56(52)65)66-47-23-16-22-46(37-47)63-40-64(55-29-13-12-28-54(55)63)58-49(42-18-14-20-44(35-42)60(4,5)6)25-17-26-50(58)43-19-15-21-45(36-43)61(7,8)9/h10-38H,39H2,1-9H3/i39D2 |
| InChIKey | BUHANKJFOPWLLJ-CAOGJSQRSA-N |
| XLogP | 15.51 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.17 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|