C54H44N4O — CID 171610949
6-tert-butyl-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole (PubChem CID 171610949) has the molecular formula C54H44N4O and a molecular weight of 764.97 g/mol. Its IUPAC name is 6-tert-butyl-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole.
| Compound Name | 6-tert-butyl-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 171610949 |
| Molecular Formula | C54H44N4O |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 764.35 |
| IUPAC Name | 6-tert-butyl-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-ethyl-2-pyridinyl)carbazole |
| SMILES | CCc1ccnc(-n2c3ccc(C(C)(C)C)cc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C54H44N4O/c1-5-37-30-31-55-52(32-37)58-48-29-26-40(54(2,3)4)33-47(48)46-28-27-43(35-51(46)58)59-42-21-14-20-41(34-42)56-36-57(50-25-13-12-24-49(50)56)53-44(38-16-8-6-9-17-38)22-15-23-45(53)39-18-10-7-11-19-39/h6-35H,5H2,1-4H3 |
| InChIKey | KRBNHFTYBZKBNG-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|