C60H48N4O — CID 171610260
9-[5-(4-tert-butylphenyl)-4-ethyl-2-pyridinyl]-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole (PubChem CID 171610260) has the molecular formula C60H48N4O and a molecular weight of 841.07 g/mol. Its IUPAC name is 9-[5-(4-tert-butylphenyl)-4-ethyl-2-pyridinyl]-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole.
| Compound Name | 9-[5-(4-tert-butylphenyl)-4-ethyl-2-pyridinyl]-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
|---|---|
| PubChem CID | 171610260 |
| Molecular Formula | C60H48N4O |
| Molecular Weight | 841.07 g/mol |
| Exact Mass | 840.38 |
| IUPAC Name | 9-[5-(4-tert-butylphenyl)-4-ethyl-2-pyridinyl]-2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
| SMILES | CCc1cc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)c4)cc32)ncc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C60H48N4O/c1-5-41-36-58(61-39-53(41)44-30-32-45(33-31-44)60(2,3)4)64-54-27-13-12-24-51(54)52-35-34-48(38-57(52)64)65-47-23-16-22-46(37-47)62-40-63(56-29-15-14-28-55(56)62)59-49(42-18-8-6-9-19-42)25-17-26-50(59)43-20-10-7-11-21-43/h6-39H,5H2,1-4H3 |
| InChIKey | YZYCWLVKYLLBBF-UHFFFAOYSA-N |
| XLogP | 14.85 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.07 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|