C68H54N4O — CID 176596470
2-[3-[3-(3-tert-butyl-2-phenyltetraphenylen-1-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 176596470) has the molecular formula C68H54N4O and a molecular weight of 943.21 g/mol. Its IUPAC name is 2-[3-[3-(3-tert-butyl-2-phenyltetraphenylen-1-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[3-(3-tert-butyl-2-phenyltetraphenylen-1-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 176596470 |
| Molecular Formula | C68H54N4O |
| Molecular Weight | 943.21 g/mol |
| Exact Mass | 942.43 |
| IUPAC Name | 2-[3-[3-(3-tert-butyl-2-phenyltetraphenylen-1-yl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c7c(cc(C(C)(C)C)c6-c6ccccc6)-c6ccccc6-c6ccccc6-c6ccccc6-7)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C68H54N4O/c1-67(2,3)45-37-38-69-63(39-45)72-59-32-17-16-30-54(59)55-36-35-48(41-62(55)72)73-47-24-20-23-46(40-47)70-43-71(61-34-19-18-33-60(61)70)66-64(44-21-8-7-9-22-44)58(68(4,5)6)42-57-53-29-13-12-27-51(53)49-25-10-11-26-50(49)52-28-14-15-31-56(52)65(57)66/h7-42H,1-6H3/b51-49-,52-50-,57-53-,65-56+ |
| InChIKey | REDJLABRLFBLKZ-LBWPEMTESA-N |
| XLogP | 17.24 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.21 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|