C48H48N4O — CID 168813456
9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole (PubChem CID 168813456) has the molecular formula C48H48N4O and a molecular weight of 696.94 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
|---|---|
| PubChem CID | 168813456 |
| Molecular Formula | C48H48N4O |
| Molecular Weight | 696.94 g/mol |
| Exact Mass | 696.38 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H48N4O/c1-46(2,3)32-23-24-49-45(28-32)52-41-18-11-10-17-39(41)40-22-21-38(30-44(40)52)53-37-16-14-15-35(29-37)50-31-51(43-20-13-12-19-42(43)50)36-26-33(47(4,5)6)25-34(27-36)48(7,8)9/h10-30H,1-9H3 |
| InChIKey | BNTKWWCPZRCIGW-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.94 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|