C39H38N4O — CID 176775981
2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 176775981) has the molecular formula C39H38N4O and a molecular weight of 578.76 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 176775981 |
| Molecular Formula | C39H38N4O |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 2-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-3-ium-2-id-1-yl)phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | C[n+]1[c-]n(-c2cc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc(C(C)(C)C)c2)c2ccccc21 |
| InChI | InChI=1S/C39H38N4O/c1-38(2,3)26-18-19-40-37(22-26)43-33-13-9-8-12-31(33)32-17-16-29(24-36(32)43)44-30-21-27(39(4,5)6)20-28(23-30)42-25-41(7)34-14-10-11-15-35(34)42/h8-24H,1-7H3 |
| InChIKey | AGDXOQRBGHFXEV-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|