C47H46FN5O — CID 171765855
9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-7-fluorocarbazole (PubChem CID 171765855) has the molecular formula C47H46FN5O and a molecular weight of 715.92 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-7-fluorocarbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-7-fluorocarbazole |
|---|---|
| PubChem CID | 171765855 |
| Molecular Formula | C47H46FN5O |
| Molecular Weight | 715.92 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[5-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-7-fluorocarbazole |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3cncc(Oc4ccc5c6ccc(F)cc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H46FN5O/c1-45(2,3)30-18-19-50-44(23-30)53-42-24-33(48)14-16-38(42)39-17-15-36(26-43(39)53)54-37-25-35(27-49-28-37)52-29-51(40-12-10-11-13-41(40)52)34-21-31(46(4,5)6)20-32(22-34)47(7,8)9/h10-28H,1-9H3 |
| InChIKey | WCJINPQVQAGQGY-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.92 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|