C59H62N4O — CID 163537166
2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]carbazole (PubChem CID 163537166) has the molecular formula C59H62N4O and a molecular weight of 843.17 g/mol. Its IUPAC name is 2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]carbazole.
| Compound Name | 2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 163537166 |
| Molecular Formula | C59H62N4O |
| Molecular Weight | 843.17 g/mol |
| Exact Mass | 842.49 |
| IUPAC Name | 2-[3-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-9-[4-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]carbazole |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccnc(-n3c4ccccc4c4ccc(Oc5cccc(-n6[c-][n+](-c7cc(C(C)(C)C)cc(C(C)(C)C)c7)c7ccccc76)c5)cc43)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C59H62N4O/c1-37(2)41-28-50(38(3)4)57(51(29-41)39(5)6)40-26-27-60-56(30-40)63-52-21-14-13-20-48(52)49-25-24-47(35-55(49)63)64-46-19-17-18-44(34-46)61-36-62(54-23-16-15-22-53(54)61)45-32-42(58(7,8)9)31-43(33-45)59(10,11)12/h13-35,37-39H,1-12H3 |
| InChIKey | PAGSCYHKWYINKA-UHFFFAOYSA-N |
| XLogP | 15.62 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.17 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|