C53H51N5O — CID 171765234
2-[[5-[3-[3,5-bis(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole (PubChem CID 171765234) has the molecular formula C53H51N5O and a molecular weight of 778.05 g/mol. Its IUPAC name is 2-[[5-[3-[3,5-bis(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole.
| Compound Name | 2-[[5-[3-[3,5-bis(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole |
|---|---|
| PubChem CID | 171765234 |
| Molecular Formula | C53H51N5O |
| Molecular Weight | 778.05 g/mol |
| Exact Mass | 777.43 |
| IUPAC Name | 2-[[5-[3-[3,5-bis(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole |
| SMILES | [2H]C([2H])(c1cc(-[n+]2[c-]n(-c3cncc(Oc4ccc5c6cc(-c7ccccc7)ccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)cc(C([2H])([2H])C(C)C)c1)C(C)C |
| InChI | InChI=1S/C53H51N5O/c1-35(2)23-37-25-38(24-36(3)4)27-42(26-37)56-34-57(50-16-12-11-15-49(50)56)43-30-45(33-54-32-43)59-44-18-19-46-47-28-40(39-13-9-8-10-14-39)17-20-48(47)58(51(46)31-44)52-29-41(21-22-55-52)53(5,6)7/h8-22,25-33,35-36H,23-24H2,1-7H3/i23D2,24D2 |
| InChIKey | KMTOZDQKUNWFAY-VBUDNUALSA-N |
| XLogP | 12.75 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.05 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|