C47H47N5O — CID 171765902
2-[[2-tert-butyl-5-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 171765902) has the molecular formula C47H47N5O and a molecular weight of 699.94 g/mol. Its IUPAC name is 2-[[2-tert-butyl-5-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[[2-tert-butyl-5-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 171765902 |
| Molecular Formula | C47H47N5O |
| Molecular Weight | 699.94 g/mol |
| Exact Mass | 699.39 |
| IUPAC Name | 2-[[2-tert-butyl-5-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-benzimidazol-3-ium-2-id-1-yl]-3-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | [2H]C([2H])(c1cccc(-[n+]2[c-]n(-c3cnc(C(C)(C)C)c(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)c1)C(C)C |
| InChI | InChI=1S/C47H47N5O/c1-31(2)24-32-14-13-15-34(25-32)50-30-51(41-19-12-11-18-40(41)50)35-27-43(45(49-29-35)47(6,7)8)53-36-20-21-38-37-16-9-10-17-39(37)52(42(38)28-36)44-26-33(22-23-48-44)46(3,4)5/h9-23,25-29,31H,24H2,1-8H3/i24D2 |
| InChIKey | WLEFCWNTFJEEAH-XRAPWQDJSA-N |
| XLogP | 11.18 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.94 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|