C39H37N5O — CID 171765312
9-(4-tert-butyl-2-pyridinyl)-2-[[2-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]carbazole (PubChem CID 171765312) has the molecular formula C39H37N5O and a molecular weight of 593.77 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[[2-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[2-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]carbazole |
|---|---|
| PubChem CID | 171765312 |
| Molecular Formula | C39H37N5O |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[2-[3-[3-(1,1-dideuterio-2-methylpropyl)phenyl]-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]carbazole |
| SMILES | [2H]C([2H])(c1cccc(-[n+]2[c-]n(-c3cc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)ccn3)cc2)c1)C(C)C |
| InChI | InChI=1S/C39H37N5O/c1-27(2)21-28-9-8-10-30(22-28)42-19-20-43(26-42)37-25-32(16-18-40-37)45-31-13-14-34-33-11-6-7-12-35(33)44(36(34)24-31)38-23-29(15-17-41-38)39(3,4)5/h6-20,22-25,27H,21H2,1-5H3/i21D2 |
| InChIKey | SRNAMSFUJXEIMC-GQZVJHRESA-N |
| XLogP | 8.73 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|