C36H30N4O — CID 164788662
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole (PubChem CID 164788662) has the molecular formula C36H30N4O and a molecular weight of 534.66 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole |
|---|---|
| PubChem CID | 164788662 |
| Molecular Formula | C36H30N4O |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenyl-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6ccccc6)cc5)c4)cc32)c1 |
| InChI | InChI=1S/C36H30N4O/c1-36(2,3)26-18-19-37-35(22-26)40-33-15-8-7-14-31(33)32-17-16-30(24-34(32)40)41-29-13-9-12-28(23-29)39-21-20-38(25-39)27-10-5-4-6-11-27/h4-24H,1-3H3 |
| InChIKey | VDADRIROVTZVBA-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|