C45H41N5O — CID 171765839
2-[[2-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 171765839) has the molecular formula C45H41N5O and a molecular weight of 667.86 g/mol. Its IUPAC name is 2-[[2-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[[2-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 171765839 |
| Molecular Formula | C45H41N5O |
| Molecular Weight | 667.86 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | 2-[[2-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(-[n+]2[c-]n(-c3cc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)ccn3)cc2)c1 |
| InChI | InChI=1S/C45H41N5O/c1-44(2,3)33-18-20-47-43(27-33)50-40-15-11-10-14-38(40)39-17-16-36(28-41(39)50)51-37-19-21-46-42(29-37)49-23-22-48(30-49)35-25-32(31-12-8-7-9-13-31)24-34(26-35)45(4,5)6/h7-29H,1-6H3 |
| InChIKey | IDCZWSJKIPZLQF-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.86 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|