C43H45N5O — CID 171765363
2-[[2-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-[4-(1,1-dideuterio-2-methylpropyl)-2-pyridinyl]carbazole (PubChem CID 171765363) has the molecular formula C43H45N5O and a molecular weight of 649.88 g/mol. Its IUPAC name is 2-[[2-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-[4-(1,1-dideuterio-2-methylpropyl)-2-pyridinyl]carbazole.
| Compound Name | 2-[[2-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-[4-(1,1-dideuterio-2-methylpropyl)-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 171765363 |
| Molecular Formula | C43H45N5O |
| Molecular Weight | 649.88 g/mol |
| Exact Mass | 649.37 |
| IUPAC Name | 2-[[2-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]-4-pyridinyl]oxy]-9-[4-(1,1-dideuterio-2-methylpropyl)-2-pyridinyl]carbazole |
| SMILES | [2H]C([2H])(c1ccnc(-n2c3ccccc3c3ccc(Oc4ccnc(-n5[c-][n+](-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)cc5)c4)cc32)c1)C(C)C |
| InChI | InChI=1S/C43H45N5O/c1-29(2)21-30-15-17-45-41(22-30)48-38-12-10-9-11-36(38)37-14-13-34(26-39(37)48)49-35-16-18-44-40(27-35)47-20-19-46(28-47)33-24-31(42(3,4)5)23-32(25-33)43(6,7)8/h9-20,22-27,29H,21H2,1-8H3/i21D2 |
| InChIKey | UXZDYZJODJUEKU-GQZVJHRESA-N |
| XLogP | 10.03 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.88 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|