C56H49N4O+ — CID 168761364
2-[3-[3-(3-tert-butyl-5-phenylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole (PubChem CID 168761364) has the molecular formula C56H49N4O+ and a molecular weight of 794.04 g/mol. Its IUPAC name is 2-[3-[3-(3-tert-butyl-5-phenylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole.
| Compound Name | 2-[3-[3-(3-tert-butyl-5-phenylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole |
|---|---|
| PubChem CID | 168761364 |
| Molecular Formula | C56H49N4O+ |
| Molecular Weight | 794.04 g/mol |
| Exact Mass | 793.39 |
| IUPAC Name | 2-[3-[3-(3-tert-butyl-5-phenylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)-6-phenylcarbazole |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(-[n+]2cn(-c3cccc(Oc4ccc5c6cc(-c7ccccc7)ccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C56H49N4O/c1-55(2,3)42-28-29-57-54(34-42)60-50-27-24-40(38-16-9-7-10-17-38)32-49(50)48-26-25-47(36-53(48)60)61-46-21-15-20-44(35-46)58-37-59(52-23-14-13-22-51(52)58)45-31-41(39-18-11-8-12-19-39)30-43(33-45)56(4,5)6/h7-37H,1-6H3/q+1 |
| InChIKey | YIAUCXNQQAIFMF-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.04 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|