C58H51N6O+ — CID 166006794
6-[3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]benzimidazol-1-ium-1-yl]-5,7-bis(trideuteriomethyl)indolo[2,3-b]carbazole (PubChem CID 166006794) has the molecular formula C58H51N6O+ and a molecular weight of 854.12 g/mol. Its IUPAC name is 6-[3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]benzimidazol-1-ium-1-yl]-5,7-bis(trideuteriomethyl)indolo[2,3-b]carbazole.
| Compound Name | 6-[3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]benzimidazol-1-ium-1-yl]-5,7-bis(trideuteriomethyl)indolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 166006794 |
| Molecular Formula | C58H51N6O+ |
| Molecular Weight | 854.12 g/mol |
| Exact Mass | 853.45 |
| IUPAC Name | 6-[3-[3-[6-tert-butyl-9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]benzimidazol-1-ium-1-yl]-5,7-bis(trideuteriomethyl)indolo[2,3-b]carbazole |
| SMILES | [2H]C([2H])([2H])n1c2ccccc2c2cc3c4ccccc4n(C([2H])([2H])[2H])c3c(-[n+]3cn(-c4cccc(Oc5ccc6c7cc(C(C)(C)C)ccc7n(-c7cc(C(C)(C)C)ccn7)c6c5)c4)c4ccccc43)c21 |
| InChI | InChI=1S/C58H51N6O/c1-57(2,3)36-24-27-49-44(30-36)43-26-25-40(33-52(43)64(49)53-31-37(28-29-59-53)58(4,5)6)65-39-17-15-16-38(32-39)62-35-63(51-23-14-13-22-50(51)62)56-54-45(41-18-9-11-20-47(41)60(54)7)34-46-42-19-10-12-21-48(42)61(8)55(46)56/h9-35H,1-8H3/q+1/i7D3,8D3 |
| InChIKey | ZWDZLLFTXIFFQY-FDSUUMENSA-N |
| XLogP | 14.08 |
| TPSA | 45.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.12 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|