C35H31IN4O — CID 137364561
9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(trideuteriomethyl)benzimidazol-3-ium-1-yl]phenoxy]carbazole iodide (PubChem CID 137364561) has the molecular formula C35H31IN4O and a molecular weight of 653.58 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(trideuteriomethyl)benzimidazol-3-ium-1-yl]phenoxy]carbazole iodide.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(trideuteriomethyl)benzimidazol-3-ium-1-yl]phenoxy]carbazole iodide |
|---|---|
| PubChem CID | 137364561 |
| Molecular Formula | C35H31IN4O |
| Molecular Weight | 653.58 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(trideuteriomethyl)benzimidazol-3-ium-1-yl]phenoxy]carbazole iodide |
| SMILES | [2H]C([2H])([2H])[n+]1cn(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c2ccccc21.[I-] |
| InChI | InChI=1S/C35H31N4O.HI/c1-35(2,3)24-18-19-36-34(20-24)39-30-13-6-5-12-28(30)29-17-16-27(22-33(29)39)40-26-11-9-10-25(21-26)38-23-37(4)31-14-7-8-15-32(31)38;/h5-23H,1-4H3;1H/q+1;/p-1/i4D3; |
| InChIKey | DFOOXZCGINSDFG-NXIGQQGZSA-M |
| XLogP | 5.04 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|