C49H37N4OSi+ — CID 174134425
[2-[2-[3-(3-methylbenzimidazol-3-ium-1-yl)phenoxy]carbazol-9-yl]-4-pyridinyl]-triphenylsilane (PubChem CID 174134425) has the molecular formula C49H37N4OSi+ and a molecular weight of 725.95 g/mol. Its IUPAC name is [2-[2-[3-(3-methylbenzimidazol-3-ium-1-yl)phenoxy]carbazol-9-yl]-4-pyridinyl]-triphenylsilane.
| Compound Name | [2-[2-[3-(3-methylbenzimidazol-3-ium-1-yl)phenoxy]carbazol-9-yl]-4-pyridinyl]-triphenylsilane |
|---|---|
| PubChem CID | 174134425 |
| Molecular Formula | C49H37N4OSi+ |
| Molecular Weight | 725.95 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | [2-[2-[3-(3-methylbenzimidazol-3-ium-1-yl)phenoxy]carbazol-9-yl]-4-pyridinyl]-triphenylsilane |
| SMILES | C[n+]1cn(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc([Si](c6ccccc6)(c6ccccc6)c6ccccc6)ccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C49H37N4OSi/c1-51-35-52(47-27-14-13-26-46(47)51)36-16-15-17-37(32-36)54-38-28-29-44-43-24-11-12-25-45(43)53(48(44)33-38)49-34-42(30-31-50-49)55(39-18-5-2-6-19-39,40-20-7-3-8-21-40)41-22-9-4-10-23-41/h2-35H,1H3/q+1 |
| InChIKey | MNZIUEQQZOTTKB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.95 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|