C37H33N4O2Pt+3 — CID 175822532
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxyimidazol-3-ium-1-yl)phenoxy]carbazole;platinum(2+) (PubChem CID 175822532) has the molecular formula C37H33N4O2Pt+3 and a molecular weight of 760.78 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxyimidazol-3-ium-1-yl)phenoxy]carbazole;platinum(2+).
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxyimidazol-3-ium-1-yl)phenoxy]carbazole;platinum(2+) |
|---|---|
| PubChem CID | 175822532 |
| Molecular Formula | C37H33N4O2Pt+3 |
| Molecular Weight | 760.78 g/mol |
| Exact Mass | 760.22 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxyimidazol-3-ium-1-yl)phenoxy]carbazole;platinum(2+) |
| SMILES | C[n+]1cc(Oc2ccccc2)n(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c1.[Pt+2] |
| InChI | InChI=1S/C37H33N4O2.Pt/c1-37(2,3)26-19-20-38-35(21-26)41-33-16-9-8-15-31(33)32-18-17-30(23-34(32)41)42-29-14-10-11-27(22-29)40-25-39(4)24-36(40)43-28-12-6-5-7-13-28;/h5-25H,1-4H3;/q+1;+2 |
| InChIKey | XGLIQSWIOJOVNQ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.78 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|