C41H34N4O — CID 170930562
7-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-5-methyl-6H-benzo[d][1,3]benzodiazepin-5-ium-6-ide (PubChem CID 170930562) has the molecular formula C41H34N4O and a molecular weight of 598.75 g/mol. Its IUPAC name is 7-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-5-methyl-6H-benzo[d][1,3]benzodiazepin-5-ium-6-ide.
| Compound Name | 7-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-5-methyl-6H-benzo[d][1,3]benzodiazepin-5-ium-6-ide |
|---|---|
| PubChem CID | 170930562 |
| Molecular Formula | C41H34N4O |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 7-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-5-methyl-6H-benzo[d][1,3]benzodiazepin-5-ium-6-ide |
| SMILES | C[N+]1=[C-]N(c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H34N4O/c1-41(2,3)28-22-23-42-40(24-28)45-38-19-10-7-16-34(38)35-21-20-31(26-39(35)45)46-30-13-11-12-29(25-30)44-27-43(4)36-17-8-5-14-32(36)33-15-6-9-18-37(33)44/h5-26H,1-4H3 |
| InChIKey | XHPDURWTPMBOQW-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 33.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|