C37H32N4O2 — CID 166029298
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxy-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole (PubChem CID 166029298) has the molecular formula C37H32N4O2 and a molecular weight of 564.69 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxy-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxy-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole |
|---|---|
| PubChem CID | 166029298 |
| Molecular Formula | C37H32N4O2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methyl-5-phenoxy-2H-imidazol-3-ium-2-id-1-yl)phenoxy]carbazole |
| SMILES | C[n+]1[c-]n(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C37H32N4O2/c1-37(2,3)26-19-20-38-35(21-26)41-33-16-9-8-15-31(33)32-18-17-30(23-34(32)41)42-29-14-10-11-27(22-29)40-25-39(4)24-36(40)43-28-12-6-5-7-13-28/h5-24H,1-4H3 |
| InChIKey | IDJKYIYOALBTTD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|