C31H29N4O+ — CID 154483088
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]carbazole (PubChem CID 154483088) has the molecular formula C31H29N4O+ and a molecular weight of 473.60 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]carbazole |
|---|---|
| PubChem CID | 154483088 |
| Molecular Formula | C31H29N4O+ |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-methylimidazol-3-ium-1-yl)phenoxy]carbazole |
| SMILES | C[n+]1ccn(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c1 |
| InChI | InChI=1S/C31H29N4O/c1-31(2,3)22-14-15-32-30(18-22)35-28-11-6-5-10-26(28)27-13-12-25(20-29(27)35)36-24-9-7-8-23(19-24)34-17-16-33(4)21-34/h5-21H,1-4H3/q+1 |
| InChIKey | VSISUOXFDKAWQY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|