C41H34N4O2 — CID 166052961
9-(4-tert-butyl-2-pyridinyl)-2-[3-[5-phenoxy-3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole (PubChem CID 166052961) has the molecular formula C41H34N4O2 and a molecular weight of 617.77 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[5-phenoxy-3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[5-phenoxy-3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
|---|---|
| PubChem CID | 166052961 |
| Molecular Formula | C41H34N4O2 |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[5-phenoxy-3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazole |
| SMILES | [2H]C([2H])([2H])[n+]1[c-]n(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C41H34N4O2/c1-41(2,3)28-21-22-42-40(23-28)45-36-16-9-8-15-34(36)35-19-17-32(25-38(35)45)47-31-14-10-11-29(24-31)44-27-43(4)39-26-33(18-20-37(39)44)46-30-12-6-5-7-13-30/h5-26H,1-4H3/i4D3 |
| InChIKey | CQNIRANHVLGEKC-GKOSEXJESA-N |
| XLogP | 9.63 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|