C43H29N5O2 — CID 166052959
10-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazol-9-yl]-4-pyridinyl]phenoxazine (PubChem CID 166052959) has the molecular formula C43H29N5O2 and a molecular weight of 650.76 g/mol. Its IUPAC name is 10-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazol-9-yl]-4-pyridinyl]phenoxazine.
| Compound Name | 10-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazol-9-yl]-4-pyridinyl]phenoxazine |
|---|---|
| PubChem CID | 166052959 |
| Molecular Formula | C43H29N5O2 |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 10-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]carbazol-9-yl]-4-pyridinyl]phenoxazine |
| SMILES | [2H]C([2H])([2H])[n+]1[c-]n(-c2cccc(Oc3ccc4c5ccccc5n(-c5cc(N6c7ccccc7Oc7ccccc76)ccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C43H29N5O2/c1-45-28-46(37-16-5-4-15-36(37)45)29-11-10-12-31(25-29)49-32-21-22-34-33-13-2-3-14-35(33)48(40(34)27-32)43-26-30(23-24-44-43)47-38-17-6-8-19-41(38)50-42-20-9-7-18-39(42)47/h2-27H,1H3/i1D3 |
| InChIKey | ZHWONAROJSZTCO-FIBGUPNXSA-N |
| XLogP | 10.12 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|