C54H53ClN4O — CID 138559328
9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dimethylphenyl)benzimidazol-3-ium-1-yl]-5-[2,6-di(propan-2-yl)phenyl]phenoxy]carbazole chloride (PubChem CID 138559328) has the molecular formula C54H53ClN4O and a molecular weight of 809.50 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dimethylphenyl)benzimidazol-3-ium-1-yl]-5-[2,6-di(propan-2-yl)phenyl]phenoxy]carbazole chloride.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dimethylphenyl)benzimidazol-3-ium-1-yl]-5-[2,6-di(propan-2-yl)phenyl]phenoxy]carbazole chloride |
|---|---|
| PubChem CID | 138559328 |
| Molecular Formula | C54H53ClN4O |
| Molecular Weight | 809.50 g/mol |
| Exact Mass | 808.39 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-(2,6-dimethylphenyl)benzimidazol-3-ium-1-yl]-5-[2,6-di(propan-2-yl)phenyl]phenoxy]carbazole chloride |
| SMILES | Cc1cccc(C)c1-[n+]1cn(-c2cc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc(-c3c(C(C)C)cccc3C(C)C)c2)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C54H53N4O.ClH/c1-34(2)43-19-15-20-44(35(3)4)52(43)38-28-40(56-33-57(49-23-13-12-22-48(49)56)53-36(5)16-14-17-37(53)6)31-42(29-38)59-41-24-25-46-45-18-10-11-21-47(45)58(50(46)32-41)51-30-39(26-27-55-51)54(7,8)9;/h10-35H,1-9H3;1H/q+1;/p-1 |
| InChIKey | QSJCDRUGFKYGIY-UHFFFAOYSA-M |
| XLogP | 11.02 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.50 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|