C48H49ClN4O — CID 138559353
2-[3-tert-butyl-5-[3-(2-tert-butylphenyl)benzimidazol-1-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole chloride (PubChem CID 138559353) has the molecular formula C48H49ClN4O and a molecular weight of 733.40 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[3-(2-tert-butylphenyl)benzimidazol-1-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole chloride.
| Compound Name | 2-[3-tert-butyl-5-[3-(2-tert-butylphenyl)benzimidazol-1-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole chloride |
|---|---|
| PubChem CID | 138559353 |
| Molecular Formula | C48H49ClN4O |
| Molecular Weight | 733.40 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | 2-[3-tert-butyl-5-[3-(2-tert-butylphenyl)benzimidazol-1-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole chloride |
| SMILES | CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc(-[n+]2cn(-c3ccccc3C(C)(C)C)c3ccccc32)c1.[Cl-] |
| InChI | InChI=1S/C48H49N4O.ClH/c1-46(2,3)32-24-25-49-45(28-32)52-40-18-12-10-16-37(40)38-23-22-35(30-44(38)52)53-36-27-33(47(4,5)6)26-34(29-36)50-31-51(43-21-15-14-20-42(43)50)41-19-13-11-17-39(41)48(7,8)9;/h10-31H,1-9H3;1H/q+1;/p-1 |
| InChIKey | YIUKANZLJLAOKB-UHFFFAOYSA-M |
| XLogP | 9.09 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.40 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|