C52H56N4O+2 — CID 167415388
2-[3-tert-butyl-5-[3-(3,5-ditert-butylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 167415388) has the molecular formula C52H56N4O+2 and a molecular weight of 753.05 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[3-(3,5-ditert-butylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-[3-(3,5-ditert-butylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 167415388 |
| Molecular Formula | C52H56N4O+2 |
| Molecular Weight | 753.05 g/mol |
| Exact Mass | 752.44 |
| IUPAC Name | 2-[3-tert-butyl-5-[3-(3,5-ditert-butylphenyl)benzimidazole-1,3-diium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc([N+]2=C=[N+](c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C52H56N4O/c1-49(2,3)34-23-24-53-48(30-34)56-44-18-14-13-17-42(44)43-22-21-40(32-47(43)56)57-41-29-37(52(10,11)12)28-39(31-41)55-33-54(45-19-15-16-20-46(45)55)38-26-35(50(4,5)6)25-36(27-38)51(7,8)9/h13-32H,1-12H3/q+2 |
| InChIKey | YGAJNZNSVYYRBY-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 33.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.05 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|