C47H47N5O+2 — CID 158103039
3-[3-tert-butyl-5-[3-(2-tert-butylphenyl)-4,5,6,7-tetradeuteriobenzimidazole-1,3-diium-1-yl]phenoxy]-5-(4-tert-butyl-2-pyridinyl)pyrido[3,2-b]indole (PubChem CID 158103039) has the molecular formula C47H47N5O+2 and a molecular weight of 701.95 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[3-(2-tert-butylphenyl)-4,5,6,7-tetradeuteriobenzimidazole-1,3-diium-1-yl]phenoxy]-5-(4-tert-butyl-2-pyridinyl)pyrido[3,2-b]indole.
| Compound Name | 3-[3-tert-butyl-5-[3-(2-tert-butylphenyl)-4,5,6,7-tetradeuteriobenzimidazole-1,3-diium-1-yl]phenoxy]-5-(4-tert-butyl-2-pyridinyl)pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 158103039 |
| Molecular Formula | C47H47N5O+2 |
| Molecular Weight | 701.95 g/mol |
| Exact Mass | 701.40 |
| IUPAC Name | 3-[3-tert-butyl-5-[3-(2-tert-butylphenyl)-4,5,6,7-tetradeuteriobenzimidazole-1,3-diium-1-yl]phenoxy]-5-(4-tert-butyl-2-pyridinyl)pyrido[3,2-b]indole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])[N+](c1cc(Oc3cnc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc(C(C)(C)C)c1)=C=[N+]2c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C47H47N5O/c1-45(2,3)31-22-23-48-43(26-31)52-38-18-12-10-16-36(38)44-42(52)28-35(29-49-44)53-34-25-32(46(4,5)6)24-33(27-34)50-30-51(41-21-15-14-20-40(41)50)39-19-13-11-17-37(39)47(7,8)9/h10-29H,1-9H3/q+2/i14D,15D,20D,21D |
| InChIKey | XDUWHNFUJSYLMI-BYQAWIJASA-N |
| XLogP | 12.12 |
| TPSA | 45.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.95 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|